C14H15IN2 — CID 114257958
6-iodo-5-methyl-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 114257958) has the molecular formula C14H15IN2 and a molecular weight of 338.19 g/mol. Its IUPAC name is 6-iodo-5-methyl-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | 6-iodo-5-methyl-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 114257958 |
| Molecular Formula | C14H15IN2 |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 6-iodo-5-methyl-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | Cc1c(I)ccc2c(N)c3c(nc12)CCCC3 |
| InChI | InChI=1S/C14H15IN2/c1-8-11(15)7-6-10-13(16)9-4-2-3-5-12(9)17-14(8)10/h6-7H,2-5H2,1H3,(H2,16,17) |
| InChIKey | VJTMJVQNRXJNIH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|