C10H10Cl2N4O — CID 114274024
3,5-dichloro-6-(4-methoxypyrazol-1-yl)-N-methylpyridin-2-amine (PubChem CID 114274024) has the molecular formula C10H10Cl2N4O and a molecular weight of 273.12 g/mol. Its IUPAC name is 3,5-dichloro-6-(4-methoxypyrazol-1-yl)-N-methylpyridin-2-amine.
| Compound Name | 3,5-dichloro-6-(4-methoxypyrazol-1-yl)-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 114274024 |
| Molecular Formula | C10H10Cl2N4O |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 3,5-dichloro-6-(4-methoxypyrazol-1-yl)-N-methylpyridin-2-amine |
| SMILES | CNc1nc(-n2cc(OC)cn2)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H10Cl2N4O/c1-13-9-7(11)3-8(12)10(15-9)16-5-6(17-2)4-14-16/h3-5H,1-2H3,(H,13,15) |
| InChIKey | BZJZWPHXMXXLFV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |