C9H19O11P — CID 11427605
(2R,4R,5R,6R,7R)-2,4,5,6,7,8-hexahydroxy-2-(phosphonomethyl)octanoic acid (PubChem CID 11427605) has the molecular formula C9H19O11P and a molecular weight of 334.21 g/mol. Its IUPAC name is (2R,4R,5R,6R,7R)-2,4,5,6,7,8-hexahydroxy-2-(phosphonomethyl)octanoic acid.
| Compound Name | (2R,4R,5R,6R,7R)-2,4,5,6,7,8-hexahydroxy-2-(phosphonomethyl)octanoic acid |
|---|---|
| PubChem CID | 11427605 |
| Molecular Formula | C9H19O11P |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | (2R,4R,5R,6R,7R)-2,4,5,6,7,8-hexahydroxy-2-(phosphonomethyl)octanoic acid |
| SMILES | O=C(O)[C@](O)(C[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)CP(=O)(O)O |
| InChI | InChI=1S/C9H19O11P/c10-2-5(12)7(14)6(13)4(11)1-9(17,8(15)16)3-21(18,19)20/h4-7,10-14,17H,1-3H2,(H,15,16)(H2,18,19,20)/t4-,5-,6-,7-,9+/m1/s1 |
| InChIKey | HQIOGHLWXQIILP-BTPGUECKSA-N |
| XLogP | -4.19 |
| TPSA | 216.21 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | -4.19 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|