C19H23ClO7 — CID 11429458
(1S,8R,9S,12R,13R,14R,15R,16S)-15-chloro-8,13,14-trihydroxy-1,12-dimethyl-6-propan-2-yl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,6-diene-4,11-dione (PubChem CID 11429458) has the molecular formula C19H23ClO7 and a molecular weight of 398.84 g/mol. Its IUPAC name is (1S,8R,9S,12R,13R,14R,15R,16S)-15-chloro-8,13,14-trihydroxy-1,12-dimethyl-6-propan-2-yl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,6-diene-4,11-dione.
| Compound Name | (1S,8R,9S,12R,13R,14R,15R,16S)-15-chloro-8,13,14-trihydroxy-1,12-dimethyl-6-propan-2-yl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,6-diene-4,11-dione |
|---|---|
| PubChem CID | 11429458 |
| Molecular Formula | C19H23ClO7 |
| Molecular Weight | 398.84 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | (1S,8R,9S,12R,13R,14R,15R,16S)-15-chloro-8,13,14-trihydroxy-1,12-dimethyl-6-propan-2-yl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,6-diene-4,11-dione |
| SMILES | CC(C)c1oc(=O)cc2c1[C@@H](O)[C@H]1OC(=O)[C@@]3(C)[C@@H](O)[C@@H](O)[C@H](Cl)[C@@]2(C)[C@@H]13 |
| InChI | InChI=1S/C19H23ClO7/c1-6(2)12-9-7(5-8(21)26-12)18(3)14-13(10(9)22)27-17(25)19(14,4)16(24)11(23)15(18)20/h5-6,10-11,13-16,22-24H,1-4H3/t10-,11+,13-,14-,15+,16+,18-,19-/m1/s1 |
| InChIKey | JQTUIDMFWHSNIR-FVVYXKAMSA-N |
| XLogP | 0.96 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.84 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|