C16H12Cl2F3NO2S — CID 11429760
N-[(Z)-1,3-dichloro-1-[3-(trifluoromethyl)phenyl]prop-1-en-2-yl]benzenesulfonamide (PubChem CID 11429760) has the molecular formula C16H12Cl2F3NO2S and a molecular weight of 410.24 g/mol. Its IUPAC name is N-[(Z)-1,3-dichloro-1-[3-(trifluoromethyl)phenyl]prop-1-en-2-yl]benzenesulfonamide.
| Compound Name | N-[(Z)-1,3-dichloro-1-[3-(trifluoromethyl)phenyl]prop-1-en-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 11429760 |
| Molecular Formula | C16H12Cl2F3NO2S |
| Molecular Weight | 410.24 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | N-[(Z)-1,3-dichloro-1-[3-(trifluoromethyl)phenyl]prop-1-en-2-yl]benzenesulfonamide |
| SMILES | O=S(=O)(N/C(CCl)=C(\Cl)c1cccc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C16H12Cl2F3NO2S/c17-10-14(22-25(23,24)13-7-2-1-3-8-13)15(18)11-5-4-6-12(9-11)16(19,20)21/h1-9,22H,10H2/b15-14- |
| InChIKey | VBDVNJUEUYVYKF-PFONDFGASA-N |
| XLogP | 4.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.24 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|