C20H23Cl2NO2S — CID 134935915
N-[(Z)-1,3-dichloro-1-(4-pentylphenyl)prop-1-en-2-yl]benzenesulfonamide (PubChem CID 134935915) has the molecular formula C20H23Cl2NO2S and a molecular weight of 412.38 g/mol. Its IUPAC name is N-[(Z)-1,3-dichloro-1-(4-pentylphenyl)prop-1-en-2-yl]benzenesulfonamide.
| Compound Name | N-[(Z)-1,3-dichloro-1-(4-pentylphenyl)prop-1-en-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 134935915 |
| Molecular Formula | C20H23Cl2NO2S |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | N-[(Z)-1,3-dichloro-1-(4-pentylphenyl)prop-1-en-2-yl]benzenesulfonamide |
| SMILES | CCCCCc1ccc(/C(Cl)=C(\CCl)NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H23Cl2NO2S/c1-2-3-5-8-16-11-13-17(14-12-16)20(22)19(15-21)23-26(24,25)18-9-6-4-7-10-18/h4,6-7,9-14,23H,2-3,5,8,15H2,1H3/b20-19- |
| InChIKey | NJVSCCJDQFNAQQ-VXPUYCOJSA-N |
| XLogP | 5.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|