C23H32Si2 — CID 11451382
dimethyl-phenyl-(6-phenyl-1-trimethylsilylhexa-1,2-dienyl)silane (PubChem CID 11451382) has the molecular formula C23H32Si2 and a molecular weight of 364.68 g/mol. Its IUPAC name is dimethyl-phenyl-(6-phenyl-1-trimethylsilylhexa-1,2-dienyl)silane.
| Compound Name | dimethyl-phenyl-(6-phenyl-1-trimethylsilylhexa-1,2-dienyl)silane |
|---|---|
| PubChem CID | 11451382 |
| Molecular Formula | C23H32Si2 |
| Molecular Weight | 364.68 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | dimethyl-phenyl-(6-phenyl-1-trimethylsilylhexa-1,2-dienyl)silane |
| SMILES | C[Si](C)(C)C(=C=CCCCc1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C23H32Si2/c1-24(2,3)23(25(4,5)22-18-12-8-13-19-22)20-14-7-11-17-21-15-9-6-10-16-21/h6,8-10,12-16,18-19H,7,11,17H2,1-5H3 |
| InChIKey | KPTANQHVGYROIG-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.68 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|