C23H30OSi — CID 44604092
7-[dimethyl(phenyl)silyl]-9-phenylnona-5,6-dien-1-ol (PubChem CID 44604092) has the molecular formula C23H30OSi and a molecular weight of 350.58 g/mol. Its IUPAC name is 7-[dimethyl(phenyl)silyl]-9-phenylnona-5,6-dien-1-ol.
| Compound Name | 7-[dimethyl(phenyl)silyl]-9-phenylnona-5,6-dien-1-ol |
|---|---|
| PubChem CID | 44604092 |
| Molecular Formula | C23H30OSi |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 7-[dimethyl(phenyl)silyl]-9-phenylnona-5,6-dien-1-ol |
| SMILES | C[Si](C)(C(=C=CCCCCO)CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H30OSi/c1-25(2,22-15-10-6-11-16-22)23(17-9-3-4-12-20-24)19-18-21-13-7-5-8-14-21/h5-11,13-16,24H,3-4,12,18-20H2,1-2H3 |
| InChIKey | PBDJGZMAJOAZLC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|