C19H27ClN2O3 — CID 11451439
ethyl 5-chloro-1-heptan-4-yl-7-methyl-4-oxo-2,3-dihydro-1,6-naphthyridine-3-carboxylate (PubChem CID 11451439) has the molecular formula C19H27ClN2O3 and a molecular weight of 366.89 g/mol. Its IUPAC name is ethyl 5-chloro-1-heptan-4-yl-7-methyl-4-oxo-2,3-dihydro-1,6-naphthyridine-3-carboxylate.
| Compound Name | ethyl 5-chloro-1-heptan-4-yl-7-methyl-4-oxo-2,3-dihydro-1,6-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 11451439 |
| Molecular Formula | C19H27ClN2O3 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | ethyl 5-chloro-1-heptan-4-yl-7-methyl-4-oxo-2,3-dihydro-1,6-naphthyridine-3-carboxylate |
| SMILES | CCCC(CCC)N1CC(C(=O)OCC)C(=O)c2c1cc(C)nc2Cl |
| InChI | InChI=1S/C19H27ClN2O3/c1-5-8-13(9-6-2)22-11-14(19(24)25-7-3)17(23)16-15(22)10-12(4)21-18(16)20/h10,13-14H,5-9,11H2,1-4H3 |
| InChIKey | ZSEPWKVPNXRXAV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|