C18H18ClN3O3S — CID 59506448
ethyl 8-benzyl-4-chloro-2-methylsulfanyl-5-oxo-6,7-dihydropyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 59506448) has the molecular formula C18H18ClN3O3S and a molecular weight of 391.88 g/mol. Its IUPAC name is ethyl 8-benzyl-4-chloro-2-methylsulfanyl-5-oxo-6,7-dihydropyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 8-benzyl-4-chloro-2-methylsulfanyl-5-oxo-6,7-dihydropyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 59506448 |
| Molecular Formula | C18H18ClN3O3S |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | ethyl 8-benzyl-4-chloro-2-methylsulfanyl-5-oxo-6,7-dihydropyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1CN(Cc2ccccc2)c2nc(SC)nc(Cl)c2C1=O |
| InChI | InChI=1S/C18H18ClN3O3S/c1-3-25-17(24)12-10-22(9-11-7-5-4-6-8-11)16-13(14(12)23)15(19)20-18(21-16)26-2/h4-8,12H,3,9-10H2,1-2H3 |
| InChIKey | ZVVQWDSAESTJQE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|