C13H17N3O3S — CID 70615701
ethyl 8-ethyl-2-methyl-5-oxo-4-sulfanylidene-6,7-dihydro-1H-pyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 70615701) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is ethyl 8-ethyl-2-methyl-5-oxo-4-sulfanylidene-6,7-dihydro-1H-pyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 8-ethyl-2-methyl-5-oxo-4-sulfanylidene-6,7-dihydro-1H-pyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 70615701 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | ethyl 8-ethyl-2-methyl-5-oxo-4-sulfanylidene-6,7-dihydro-1H-pyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1CN(CC)c2[nH]c(C)nc(=S)c2C1=O |
| InChI | InChI=1S/C13H17N3O3S/c1-4-16-6-8(13(18)19-5-2)10(17)9-11(16)14-7(3)15-12(9)20/h8H,4-6H2,1-3H3,(H,14,15,20) |
| InChIKey | IVVMFIOIWPUHDU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|