C16H23F3N4O7 — CID 11453473
(2,5-dioxopyrrolidin-1-yl) N-[(1R)-2-methyl-1-[[(2S)-pyrrolidin-1-ium-2-carbonyl]amino]propyl]carbamate;2,2,2-trifluoroacetate (PubChem CID 11453473) has the molecular formula C16H23F3N4O7 and a molecular weight of 440.38 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) N-[(1R)-2-methyl-1-[[(2S)-pyrrolidin-1-ium-2-carbonyl]amino]propyl]carbamate;2,2,2-trifluoroacetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) N-[(1R)-2-methyl-1-[[(2S)-pyrrolidin-1-ium-2-carbonyl]amino]propyl]carbamate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 11453473 |
| Molecular Formula | C16H23F3N4O7 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) N-[(1R)-2-methyl-1-[[(2S)-pyrrolidin-1-ium-2-carbonyl]amino]propyl]carbamate;2,2,2-trifluoroacetate |
| SMILES | CC(C)[C@@H](NC(=O)ON1C(=O)CCC1=O)NC(=O)[C@@H]1CCC[NH2+]1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C14H22N4O5.C2HF3O2/c1-8(2)12(16-13(21)9-4-3-7-15-9)17-14(22)23-18-10(19)5-6-11(18)20;3-2(4,5)1(6)7/h8-9,12,15H,3-7H2,1-2H3,(H,16,21)(H,17,22);(H,6,7)/t9-,12+;/m0./s1 |
| InChIKey | LXEYITUCALDSJX-PKKHVXKMSA-N |
| XLogP | -2.10 |
| TPSA | 161.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|