C31H44N4O8Si — CID 11456371
[(2S,3S)-4-[[(1R,2R)-2-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-1-phenylpropyl]-methylamino]-3-azido-2-(methoxymethoxy)-4-oxobutyl] benzoate (PubChem CID 11456371) has the molecular formula C31H44N4O8Si and a molecular weight of 628.80 g/mol. Its IUPAC name is [(2S,3S)-4-[[(1R,2R)-2-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-1-phenylpropyl]-methylamino]-3-azido-2-(methoxymethoxy)-4-oxobutyl] benzoate.
| Compound Name | [(2S,3S)-4-[[(1R,2R)-2-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-1-phenylpropyl]-methylamino]-3-azido-2-(methoxymethoxy)-4-oxobutyl] benzoate |
|---|---|
| PubChem CID | 11456371 |
| Molecular Formula | C31H44N4O8Si |
| Molecular Weight | 628.80 g/mol |
| Exact Mass | 628.29 |
| IUPAC Name | [(2S,3S)-4-[[(1R,2R)-2-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-1-phenylpropyl]-methylamino]-3-azido-2-(methoxymethoxy)-4-oxobutyl] benzoate |
| SMILES | COCO[C@H](COC(=O)c1ccccc1)[C@H](N=[N+]=[N-])C(=O)N(C)[C@H](c1ccccc1)[C@H](CO[Si](C)(C)C(C)(C)C)OC(C)=O |
| InChI | InChI=1S/C31H44N4O8Si/c1-22(36)43-26(20-42-44(7,8)31(2,3)4)28(23-15-11-9-12-16-23)35(5)29(37)27(33-34-32)25(41-21-39-6)19-40-30(38)24-17-13-10-14-18-24/h9-18,25-28H,19-21H2,1-8H3/t25-,26+,27+,28-/m1/s1 |
| InChIKey | RHEHTMLRIUPUDL-WXIAYYLYSA-N |
| XLogP | 5.66 |
| TPSA | 149.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.80 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|