C10H19ClN2O4S — CID 114632202
propan-2-yl N-[(3-chloro-2,2-dimethylcyclobutyl)sulfamoyl]carbamate (PubChem CID 114632202) has the molecular formula C10H19ClN2O4S and a molecular weight of 298.79 g/mol. Its IUPAC name is propan-2-yl N-[(3-chloro-2,2-dimethylcyclobutyl)sulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[(3-chloro-2,2-dimethylcyclobutyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114632202 |
| Molecular Formula | C10H19ClN2O4S |
| Molecular Weight | 298.79 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | propan-2-yl N-[(3-chloro-2,2-dimethylcyclobutyl)sulfamoyl]carbamate |
| SMILES | CC(C)OC(=O)NS(=O)(=O)NC1CC(Cl)C1(C)C |
| InChI | InChI=1S/C10H19ClN2O4S/c1-6(2)17-9(14)13-18(15,16)12-8-5-7(11)10(8,3)4/h6-8,12H,5H2,1-4H3,(H,13,14) |
| InChIKey | MUIQGUJSYJBYRY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.79 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|