C13H17F2N3O — CID 114632507
1-(3-amino-2,2-dimethylcyclobutyl)-3-(2,4-difluorophenyl)urea (PubChem CID 114632507) has the molecular formula C13H17F2N3O and a molecular weight of 269.30 g/mol. Its IUPAC name is 1-(3-amino-2,2-dimethylcyclobutyl)-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-(3-amino-2,2-dimethylcyclobutyl)-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 114632507 |
| Molecular Formula | C13H17F2N3O |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 1-(3-amino-2,2-dimethylcyclobutyl)-3-(2,4-difluorophenyl)urea |
| SMILES | CC1(C)C(N)CC1NC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C13H17F2N3O/c1-13(2)10(16)6-11(13)18-12(19)17-9-4-3-7(14)5-8(9)15/h3-5,10-11H,6,16H2,1-2H3,(H2,17,18,19) |
| InChIKey | QKXNFSXOCYCCLJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |