C13H23N3O4S — CID 114694302
methyl 1-(1,2,3,6-tetrahydropyridin-4-ylmethylsulfamoyl)piperidine-4-carboxylate (PubChem CID 114694302) has the molecular formula C13H23N3O4S and a molecular weight of 317.41 g/mol. Its IUPAC name is methyl 1-(1,2,3,6-tetrahydropyridin-4-ylmethylsulfamoyl)piperidine-4-carboxylate.
| Compound Name | methyl 1-(1,2,3,6-tetrahydropyridin-4-ylmethylsulfamoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 114694302 |
| Molecular Formula | C13H23N3O4S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | methyl 1-(1,2,3,6-tetrahydropyridin-4-ylmethylsulfamoyl)piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(S(=O)(=O)NCC2=CCNCC2)CC1 |
| InChI | InChI=1S/C13H23N3O4S/c1-20-13(17)12-4-8-16(9-5-12)21(18,19)15-10-11-2-6-14-7-3-11/h2,12,14-15H,3-10H2,1H3 |
| InChIKey | POJBCUVLHNBJCE-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|