C14H15NOS — CID 114746455
[3-(3,4-dihydro-2H-chromen-8-yl)thiophen-2-yl]methanamine (PubChem CID 114746455) has the molecular formula C14H15NOS and a molecular weight of 245.35 g/mol. Its IUPAC name is [3-(3,4-dihydro-2H-chromen-8-yl)thiophen-2-yl]methanamine.
| Compound Name | [3-(3,4-dihydro-2H-chromen-8-yl)thiophen-2-yl]methanamine |
|---|---|
| PubChem CID | 114746455 |
| Molecular Formula | C14H15NOS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | [3-(3,4-dihydro-2H-chromen-8-yl)thiophen-2-yl]methanamine |
| SMILES | NCc1sccc1-c1cccc2c1OCCC2 |
| InChI | InChI=1S/C14H15NOS/c15-9-13-11(6-8-17-13)12-5-1-3-10-4-2-7-16-14(10)12/h1,3,5-6,8H,2,4,7,9,15H2 |
| InChIKey | HDUFYOGTOCHJAU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |