C15H22BrNO3S — CID 114781050
6-(bromomethyl)-4-(2-ethylsulfonylphenyl)-2,2-dimethylmorpholine (PubChem CID 114781050) has the molecular formula C15H22BrNO3S and a molecular weight of 376.32 g/mol. Its IUPAC name is 6-(bromomethyl)-4-(2-ethylsulfonylphenyl)-2,2-dimethylmorpholine.
| Compound Name | 6-(bromomethyl)-4-(2-ethylsulfonylphenyl)-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 114781050 |
| Molecular Formula | C15H22BrNO3S |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 6-(bromomethyl)-4-(2-ethylsulfonylphenyl)-2,2-dimethylmorpholine |
| SMILES | CCS(=O)(=O)c1ccccc1N1CC(CBr)OC(C)(C)C1 |
| InChI | InChI=1S/C15H22BrNO3S/c1-4-21(18,19)14-8-6-5-7-13(14)17-10-12(9-16)20-15(2,3)11-17/h5-8,12H,4,9-11H2,1-3H3 |
| InChIKey | FGXQEBKHIBVRLX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|