C14H21N5O2 — CID 114788027
6-(2,6-dimethyloxan-4-yl)oxy-N-ethyl-7H-purin-2-amine (PubChem CID 114788027) has the molecular formula C14H21N5O2 and a molecular weight of 291.36 g/mol. Its IUPAC name is 6-(2,6-dimethyloxan-4-yl)oxy-N-ethyl-7H-purin-2-amine.
| Compound Name | 6-(2,6-dimethyloxan-4-yl)oxy-N-ethyl-7H-purin-2-amine |
|---|---|
| PubChem CID | 114788027 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 6-(2,6-dimethyloxan-4-yl)oxy-N-ethyl-7H-purin-2-amine |
| SMILES | CCNc1nc(OC2CC(C)OC(C)C2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C14H21N5O2/c1-4-15-14-18-12-11(16-7-17-12)13(19-14)21-10-5-8(2)20-9(3)6-10/h7-10H,4-6H2,1-3H3,(H2,15,16,17,18,19) |
| InChIKey | DUHPYDXGCCDXKL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |