C14H15NO5 — CID 11482791
benzyl N-[(3S,3aS,6aS)-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl]carbamate (PubChem CID 11482791) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is benzyl N-[(3S,3aS,6aS)-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl]carbamate.
| Compound Name | benzyl N-[(3S,3aS,6aS)-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl]carbamate |
|---|---|
| PubChem CID | 11482791 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | benzyl N-[(3S,3aS,6aS)-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl]carbamate |
| SMILES | O=C1C[C@@H]2OC[C@H](NC(=O)OCc3ccccc3)[C@@H]2O1 |
| InChI | InChI=1S/C14H15NO5/c16-12-6-11-13(20-12)10(8-18-11)15-14(17)19-7-9-4-2-1-3-5-9/h1-5,10-11,13H,6-8H2,(H,15,17)/t10-,11-,13-/m0/s1 |
| InChIKey | DBBNPVLOWYEPQT-GVXVVHGQSA-N |
| XLogP | 1.00 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |