C11H8ClN3O3 — CID 114844655
methyl 1-(5-chloro-2-formylphenyl)-1,2,4-triazole-3-carboxylate (PubChem CID 114844655) has the molecular formula C11H8ClN3O3 and a molecular weight of 265.66 g/mol. Its IUPAC name is methyl 1-(5-chloro-2-formylphenyl)-1,2,4-triazole-3-carboxylate.
| Compound Name | methyl 1-(5-chloro-2-formylphenyl)-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 114844655 |
| Molecular Formula | C11H8ClN3O3 |
| Molecular Weight | 265.66 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | methyl 1-(5-chloro-2-formylphenyl)-1,2,4-triazole-3-carboxylate |
| SMILES | COC(=O)c1ncn(-c2cc(Cl)ccc2C=O)n1 |
| InChI | InChI=1S/C11H8ClN3O3/c1-18-11(17)10-13-6-15(14-10)9-4-8(12)3-2-7(9)5-16/h2-6H,1H3 |
| InChIKey | MUWBHQVKVCTKPC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.66 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|