C23H34N2O12 — CID 11489443
methyl 3-[2-[[2-[2-oxo-2-[3-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropylamino]ethoxy]acetyl]amino]ethoxy]benzoate (PubChem CID 11489443) has the molecular formula C23H34N2O12 and a molecular weight of 530.53 g/mol. Its IUPAC name is methyl 3-[2-[[2-[2-oxo-2-[3-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropylamino]ethoxy]acetyl]amino]ethoxy]benzoate.
| Compound Name | methyl 3-[2-[[2-[2-oxo-2-[3-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropylamino]ethoxy]acetyl]amino]ethoxy]benzoate |
|---|---|
| PubChem CID | 11489443 |
| Molecular Formula | C23H34N2O12 |
| Molecular Weight | 530.53 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | methyl 3-[2-[[2-[2-oxo-2-[3-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropylamino]ethoxy]acetyl]amino]ethoxy]benzoate |
| SMILES | COC(=O)c1cccc(OCCNC(=O)COCC(=O)NCCCO[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)c1 |
| InChI | InChI=1S/C23H34N2O12/c1-33-22(32)14-4-2-5-15(10-14)35-9-7-25-18(28)13-34-12-17(27)24-6-3-8-36-23-21(31)20(30)19(29)16(11-26)37-23/h2,4-5,10,16,19-21,23,26,29-31H,3,6-9,11-13H2,1H3,(H,24,27)(H,25,28)/t16-,19-,20+,21+,23+/m1/s1 |
| InChIKey | RLHDXQZZEIOTTL-GGKYTPRKSA-N |
| XLogP | -2.69 |
| TPSA | 202.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.53 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|