C38H49F3O6 — CID 11490758
[(4R,6E,10E)-13-[(2R)-6-hydroxy-2,8-dimethyl-3,4-dihydrochromen-2-yl]-5-methoxy-2,6,10-trimethyltrideca-2,6,10-trien-4-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 11490758) has the molecular formula C38H49F3O6 and a molecular weight of 658.80 g/mol. Its IUPAC name is [(4R,6E,10E)-13-[(2R)-6-hydroxy-2,8-dimethyl-3,4-dihydrochromen-2-yl]-5-methoxy-2,6,10-trimethyltrideca-2,6,10-trien-4-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(4R,6E,10E)-13-[(2R)-6-hydroxy-2,8-dimethyl-3,4-dihydrochromen-2-yl]-5-methoxy-2,6,10-trimethyltrideca-2,6,10-trien-4-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 11490758 |
| Molecular Formula | C38H49F3O6 |
| Molecular Weight | 658.80 g/mol |
| Exact Mass | 658.35 |
| IUPAC Name | [(4R,6E,10E)-13-[(2R)-6-hydroxy-2,8-dimethyl-3,4-dihydrochromen-2-yl]-5-methoxy-2,6,10-trimethyltrideca-2,6,10-trien-4-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | COC(/C(C)=C/CC/C(C)=C/CC[C@]1(C)CCc2cc(O)cc(C)c2O1)[C@@H](C=C(C)C)OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C38H49F3O6/c1-25(2)22-32(46-35(43)37(45-8,38(39,40)41)30-17-10-9-11-18-30)34(44-7)27(4)16-12-14-26(3)15-13-20-36(6)21-19-29-24-31(42)23-28(5)33(29)47-36/h9-11,15-18,22-24,32,34,42H,12-14,19-21H2,1-8H3/b26-15+,27-16+/t32-,34?,36-,37+/m1/s1 |
| InChIKey | NPTUORBBNGHSCE-GUOGBPGRSA-N |
| XLogP | 9.23 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.80 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|