C36H74O6Si3 — CID 11490914
2-[(2S,4S,6R,8S,10S)-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-triethylsilyloxybutyl]-4,10-bis(triethylsilyloxy)-1,7-dioxaspiro[5.5]undecan-8-yl]ethanol (PubChem CID 11490914) has the molecular formula C36H74O6Si3 and a molecular weight of 687.24 g/mol. Its IUPAC name is 2-[(2S,4S,6R,8S,10S)-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-triethylsilyloxybutyl]-4,10-bis(triethylsilyloxy)-1,7-dioxaspiro[5.5]undecan-8-yl]ethanol.
| Compound Name | 2-[(2S,4S,6R,8S,10S)-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-triethylsilyloxybutyl]-4,10-bis(triethylsilyloxy)-1,7-dioxaspiro[5.5]undecan-8-yl]ethanol |
|---|---|
| PubChem CID | 11490914 |
| Molecular Formula | C36H74O6Si3 |
| Molecular Weight | 687.24 g/mol |
| Exact Mass | 686.48 |
| IUPAC Name | 2-[(2S,4S,6R,8S,10S)-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-triethylsilyloxybutyl]-4,10-bis(triethylsilyloxy)-1,7-dioxaspiro[5.5]undecan-8-yl]ethanol |
| SMILES | C=C(C[C@H]1C[C@](C)(O[Si](CC)(CC)CC)C[C@@]2(C[C@@H](O[Si](CC)(CC)CC)C[C@H](CCO)O2)O1)[C@@H](C)CO[Si](CC)(CC)CC |
| InChI | InChI=1S/C36H74O6Si3/c1-13-43(14-2,15-3)38-28-31(11)30(10)24-33-26-35(12,42-45(19-7,20-8)21-9)29-36(40-33)27-34(25-32(39-36)22-23-37)41-44(16-4,17-5)18-6/h31-34,37H,10,13-29H2,1-9,11-12H3/t31-,32-,33-,34-,35-,36+/m0/s1 |
| InChIKey | JHZWBQNOVAIKOA-JVYXSLHOSA-N |
| XLogP | 10.20 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.24 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|