C36H69IO5Si2 — CID 24850935
triethyl-[[(4R,6R,8R,10S,13R)-10-(5-iodo-2-methylidenepentyl)-13-methyl-4-[2-tri(propan-2-yl)silyloxyethyl]-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-yl]oxy]silane (PubChem CID 24850935) has the molecular formula C36H69IO5Si2 and a molecular weight of 765.02 g/mol. Its IUPAC name is triethyl-[[(4R,6R,8R,10S,13R)-10-(5-iodo-2-methylidenepentyl)-13-methyl-4-[2-tri(propan-2-yl)silyloxyethyl]-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-yl]oxy]silane.
| Compound Name | triethyl-[[(4R,6R,8R,10S,13R)-10-(5-iodo-2-methylidenepentyl)-13-methyl-4-[2-tri(propan-2-yl)silyloxyethyl]-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-yl]oxy]silane |
|---|---|
| PubChem CID | 24850935 |
| Molecular Formula | C36H69IO5Si2 |
| Molecular Weight | 765.02 g/mol |
| Exact Mass | 764.37 |
| IUPAC Name | triethyl-[[(4R,6R,8R,10S,13R)-10-(5-iodo-2-methylidenepentyl)-13-methyl-4-[2-tri(propan-2-yl)silyloxyethyl]-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-yl]oxy]silane |
| SMILES | C=C(CCCI)C[C@@H]1CC[C@@](C)(O[Si](CC)(CC)CC)[C@]2(CC[C@@]3(CCC[C@H](CCO[Si](C(C)C)(C(C)C)C(C)C)O3)O2)O1 |
| InChI | InChI=1S/C36H69IO5Si2/c1-12-43(13-2,14-3)42-34(11)22-19-33(27-31(10)17-16-25-37)40-36(34)24-23-35(41-36)21-15-18-32(39-35)20-26-38-44(28(4)5,29(6)7)30(8)9/h28-30,32-33H,10,12-27H2,1-9,11H3/t32-,33+,34-,35-,36-/m1/s1 |
| InChIKey | OILCKLLRZYDWMP-MWAROKLZSA-N |
| XLogP | 11.46 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.02 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|