C27H53IO4Si2 — CID 57327492
triethyl-[5-[(2S,3R,6S)-6-(5-iodo-2-methylidenepentyl)-2-methoxy-3-methyl-3-trimethylsilyloxyoxan-2-yl]pent-1-en-3-yloxy]silane (PubChem CID 57327492) has the molecular formula C27H53IO4Si2 and a molecular weight of 624.79 g/mol. Its IUPAC name is triethyl-[5-[(2S,3R,6S)-6-(5-iodo-2-methylidenepentyl)-2-methoxy-3-methyl-3-trimethylsilyloxyoxan-2-yl]pent-1-en-3-yloxy]silane.
| Compound Name | triethyl-[5-[(2S,3R,6S)-6-(5-iodo-2-methylidenepentyl)-2-methoxy-3-methyl-3-trimethylsilyloxyoxan-2-yl]pent-1-en-3-yloxy]silane |
|---|---|
| PubChem CID | 57327492 |
| Molecular Formula | C27H53IO4Si2 |
| Molecular Weight | 624.79 g/mol |
| Exact Mass | 624.25 |
| IUPAC Name | triethyl-[5-[(2S,3R,6S)-6-(5-iodo-2-methylidenepentyl)-2-methoxy-3-methyl-3-trimethylsilyloxyoxan-2-yl]pent-1-en-3-yloxy]silane |
| SMILES | C=CC(CC[C@]1(OC)O[C@H](CC(=C)CCCI)CC[C@@]1(C)O[Si](C)(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C27H53IO4Si2/c1-11-24(31-34(12-2,13-3)14-4)18-20-27(29-7)26(6,32-33(8,9)10)19-17-25(30-27)22-23(5)16-15-21-28/h11,24-25H,1,5,12-22H2,2-4,6-10H3/t24?,25-,26+,27-/m0/s1 |
| InChIKey | RMXIBNZYYDRZDX-ZAEYVGPMSA-N |
| XLogP | 8.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.79 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|