C42H72O4Si3 — CID 57327149
(3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(2S,6S)-5,5-dimethyl-6-[(2S)-2-triethylsilyloxy-4-(trimethylsilylmethyl)pent-4-enyl]oxan-2-yl]butan-1-ol (PubChem CID 57327149) has the molecular formula C42H72O4Si3 and a molecular weight of 725.29 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(2S,6S)-5,5-dimethyl-6-[(2S)-2-triethylsilyloxy-4-(trimethylsilylmethyl)pent-4-enyl]oxan-2-yl]butan-1-ol.
| Compound Name | (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(2S,6S)-5,5-dimethyl-6-[(2S)-2-triethylsilyloxy-4-(trimethylsilylmethyl)pent-4-enyl]oxan-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 57327149 |
| Molecular Formula | C42H72O4Si3 |
| Molecular Weight | 725.29 g/mol |
| Exact Mass | 724.47 |
| IUPAC Name | (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(2S,6S)-5,5-dimethyl-6-[(2S)-2-triethylsilyloxy-4-(trimethylsilylmethyl)pent-4-enyl]oxan-2-yl]butan-1-ol |
| SMILES | C=C(C[C@@H](C[C@@H]1O[C@H](C[C@H](CCO)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCC1(C)C)O[Si](CC)(CC)CC)C[Si](C)(C)C |
| InChI | InChI=1S/C42H72O4Si3/c1-13-48(14-2,15-3)45-37(30-34(4)33-47(10,11)12)32-40-42(8,9)28-26-35(44-40)31-36(27-29-43)46-49(41(5,6)7,38-22-18-16-19-23-38)39-24-20-17-21-25-39/h16-25,35-37,40,43H,4,13-15,26-33H2,1-3,5-12H3/t35-,36-,37-,40-/m0/s1 |
| InChIKey | SPOSHXINGDPNRM-HKSLQXHYSA-N |
| XLogP | 10.34 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.29 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|