C34H64O5S2Si2 — CID 11763813
[(4R,6R,8R,10S,13R)-4-(1,3-dithian-2-ylmethyl)-13-methyl-10-(2-triethylsilyloxybut-3-enyl)-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-yl]oxy-triethylsilane (PubChem CID 11763813) has the molecular formula C34H64O5S2Si2 and a molecular weight of 673.19 g/mol. Its IUPAC name is [(4R,6R,8R,10S,13R)-4-(1,3-dithian-2-ylmethyl)-13-methyl-10-(2-triethylsilyloxybut-3-enyl)-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-yl]oxy-triethylsilane.
| Compound Name | [(4R,6R,8R,10S,13R)-4-(1,3-dithian-2-ylmethyl)-13-methyl-10-(2-triethylsilyloxybut-3-enyl)-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 11763813 |
| Molecular Formula | C34H64O5S2Si2 |
| Molecular Weight | 673.19 g/mol |
| Exact Mass | 672.37 |
| IUPAC Name | [(4R,6R,8R,10S,13R)-4-(1,3-dithian-2-ylmethyl)-13-methyl-10-(2-triethylsilyloxybut-3-enyl)-5,7,9-trioxadispiro[5.1.58.26]pentadecan-13-yl]oxy-triethylsilane |
| SMILES | C=CC(C[C@@H]1CC[C@@](C)(O[Si](CC)(CC)CC)[C@]2(CC[C@@]3(CCC[C@H](CC4SCCCS4)O3)O2)O1)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C34H64O5S2Si2/c1-9-28(37-42(10-2,11-3)12-4)26-30-19-21-32(8,39-43(13-5,14-6)15-7)34(36-30)23-22-33(38-34)20-16-18-29(35-33)27-31-40-24-17-25-41-31/h9,28-31H,1,10-27H2,2-8H3/t28?,29-,30+,32-,33-,34-/m1/s1 |
| InChIKey | BRHSWJNZQLNTOH-KJDCRAEISA-N |
| XLogP | 10.27 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.19 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|