C28H56O6Si2 — CID 11663915
2-[(4R,6R,8R,10S,13R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyl-13-triethylsilyloxy-5,7,9-trioxadispiro[5.1.58.26]pentadecan-10-yl]ethanol (PubChem CID 11663915) has the molecular formula C28H56O6Si2 and a molecular weight of 544.92 g/mol. Its IUPAC name is 2-[(4R,6R,8R,10S,13R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyl-13-triethylsilyloxy-5,7,9-trioxadispiro[5.1.58.26]pentadecan-10-yl]ethanol.
| Compound Name | 2-[(4R,6R,8R,10S,13R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyl-13-triethylsilyloxy-5,7,9-trioxadispiro[5.1.58.26]pentadecan-10-yl]ethanol |
|---|---|
| PubChem CID | 11663915 |
| Molecular Formula | C28H56O6Si2 |
| Molecular Weight | 544.92 g/mol |
| Exact Mass | 544.36 |
| IUPAC Name | 2-[(4R,6R,8R,10S,13R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyl-13-triethylsilyloxy-5,7,9-trioxadispiro[5.1.58.26]pentadecan-10-yl]ethanol |
| SMILES | CC[Si](CC)(CC)O[C@]1(C)CC[C@@H](CCO)O[C@@]12CC[C@@]1(CCC[C@H](CO[Si](C)(C)C(C)(C)C)O1)O2 |
| InChI | InChI=1S/C28H56O6Si2/c1-10-36(11-2,12-3)34-26(7)18-15-23(16-21-29)32-28(26)20-19-27(33-28)17-13-14-24(31-27)22-30-35(8,9)25(4,5)6/h23-24,29H,10-22H2,1-9H3/t23-,24+,26+,27+,28+/m0/s1 |
| InChIKey | KTRHHSLNASABCE-GMQNGPPWSA-N |
| XLogP | 7.12 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.92 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|