C24H21NO4S — CID 11495437
2-[[1-(1-benzothiophen-3-ylmethoxy)naphthalene-2-carbonyl]amino]-2-methylpropanoic acid (PubChem CID 11495437) has the molecular formula C24H21NO4S and a molecular weight of 419.50 g/mol. Its IUPAC name is 2-[[1-(1-benzothiophen-3-ylmethoxy)naphthalene-2-carbonyl]amino]-2-methylpropanoic acid.
| Compound Name | 2-[[1-(1-benzothiophen-3-ylmethoxy)naphthalene-2-carbonyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 11495437 |
| Molecular Formula | C24H21NO4S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 2-[[1-(1-benzothiophen-3-ylmethoxy)naphthalene-2-carbonyl]amino]-2-methylpropanoic acid |
| SMILES | CC(C)(NC(=O)c1ccc2ccccc2c1OCc1csc2ccccc12)C(=O)O |
| InChI | InChI=1S/C24H21NO4S/c1-24(2,23(27)28)25-22(26)19-12-11-15-7-3-4-9-18(15)21(19)29-13-16-14-30-20-10-6-5-8-17(16)20/h3-12,14H,13H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | QDYXBUNZZMDMIV-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |