C24H24ClNO4 — CID 24769440
2-[[1-[3-(4-chlorophenyl)propoxy]naphthalene-2-carbonyl]amino]-2-methylpropanoic acid (PubChem CID 24769440) has the molecular formula C24H24ClNO4 and a molecular weight of 425.91 g/mol. Its IUPAC name is 2-[[1-[3-(4-chlorophenyl)propoxy]naphthalene-2-carbonyl]amino]-2-methylpropanoic acid.
| Compound Name | 2-[[1-[3-(4-chlorophenyl)propoxy]naphthalene-2-carbonyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 24769440 |
| Molecular Formula | C24H24ClNO4 |
| Molecular Weight | 425.91 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2-[[1-[3-(4-chlorophenyl)propoxy]naphthalene-2-carbonyl]amino]-2-methylpropanoic acid |
| SMILES | CC(C)(NC(=O)c1ccc2ccccc2c1OCCCc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C24H24ClNO4/c1-24(2,23(28)29)26-22(27)20-14-11-17-7-3-4-8-19(17)21(20)30-15-5-6-16-9-12-18(25)13-10-16/h3-4,7-14H,5-6,15H2,1-2H3,(H,26,27)(H,28,29) |
| InChIKey | REYXBHHPWOYYPJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.91 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|