C24H25NO6 — CID 24769730
2-[[1-[2-(2-methoxyphenoxy)ethoxy]naphthalene-2-carbonyl]amino]-2-methylpropanoic acid (PubChem CID 24769730) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is 2-[[1-[2-(2-methoxyphenoxy)ethoxy]naphthalene-2-carbonyl]amino]-2-methylpropanoic acid.
| Compound Name | 2-[[1-[2-(2-methoxyphenoxy)ethoxy]naphthalene-2-carbonyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 24769730 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 2-[[1-[2-(2-methoxyphenoxy)ethoxy]naphthalene-2-carbonyl]amino]-2-methylpropanoic acid |
| SMILES | COc1ccccc1OCCOc1c(C(=O)NC(C)(C)C(=O)O)ccc2ccccc12 |
| InChI | InChI=1S/C24H25NO6/c1-24(2,23(27)28)25-22(26)18-13-12-16-8-4-5-9-17(16)21(18)31-15-14-30-20-11-7-6-10-19(20)29-3/h4-13H,14-15H2,1-3H3,(H,25,26)(H,27,28) |
| InChIKey | AZNAWNZVEUYXSX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|