C23H22FNO5 — CID 24769729
2-[[1-[2-(3-fluorophenoxy)ethoxy]naphthalene-2-carbonyl]amino]-2-methylpropanoic acid (PubChem CID 24769729) has the molecular formula C23H22FNO5 and a molecular weight of 411.43 g/mol. Its IUPAC name is 2-[[1-[2-(3-fluorophenoxy)ethoxy]naphthalene-2-carbonyl]amino]-2-methylpropanoic acid.
| Compound Name | 2-[[1-[2-(3-fluorophenoxy)ethoxy]naphthalene-2-carbonyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 24769729 |
| Molecular Formula | C23H22FNO5 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 2-[[1-[2-(3-fluorophenoxy)ethoxy]naphthalene-2-carbonyl]amino]-2-methylpropanoic acid |
| SMILES | CC(C)(NC(=O)c1ccc2ccccc2c1OCCOc1cccc(F)c1)C(=O)O |
| InChI | InChI=1S/C23H22FNO5/c1-23(2,22(27)28)25-21(26)19-11-10-15-6-3-4-9-18(15)20(19)30-13-12-29-17-8-5-7-16(24)14-17/h3-11,14H,12-13H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | SKVJZNMBIWMNFF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|