C27H30FNO4 — CID 91446431
2-ethyl-2-[[1-[2-(3-fluorophenyl)ethoxy]naphthalene-2-carbonyl]amino]hexanoic acid (PubChem CID 91446431) has the molecular formula C27H30FNO4 and a molecular weight of 451.54 g/mol. Its IUPAC name is 2-ethyl-2-[[1-[2-(3-fluorophenyl)ethoxy]naphthalene-2-carbonyl]amino]hexanoic acid.
| Compound Name | 2-ethyl-2-[[1-[2-(3-fluorophenyl)ethoxy]naphthalene-2-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 91446431 |
| Molecular Formula | C27H30FNO4 |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 2-ethyl-2-[[1-[2-(3-fluorophenyl)ethoxy]naphthalene-2-carbonyl]amino]hexanoic acid |
| SMILES | CCCCC(CC)(NC(=O)c1ccc2ccccc2c1OCCc1cccc(F)c1)C(=O)O |
| InChI | InChI=1S/C27H30FNO4/c1-3-5-16-27(4-2,26(31)32)29-25(30)23-14-13-20-10-6-7-12-22(20)24(23)33-17-15-19-9-8-11-21(28)18-19/h6-14,18H,3-5,15-17H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | UYKCJHVAKKUCPJ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |