C27H25NO5 — CID 24768906
2-methyl-2-[[1-(2-naphthalen-2-yloxyethoxy)naphthalene-2-carbonyl]amino]propanoic acid (PubChem CID 24768906) has the molecular formula C27H25NO5 and a molecular weight of 443.50 g/mol. Its IUPAC name is 2-methyl-2-[[1-(2-naphthalen-2-yloxyethoxy)naphthalene-2-carbonyl]amino]propanoic acid.
| Compound Name | 2-methyl-2-[[1-(2-naphthalen-2-yloxyethoxy)naphthalene-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 24768906 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 2-methyl-2-[[1-(2-naphthalen-2-yloxyethoxy)naphthalene-2-carbonyl]amino]propanoic acid |
| SMILES | CC(C)(NC(=O)c1ccc2ccccc2c1OCCOc1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C27H25NO5/c1-27(2,26(30)31)28-25(29)23-14-12-19-8-5-6-10-22(19)24(23)33-16-15-32-21-13-11-18-7-3-4-9-20(18)17-21/h3-14,17H,15-16H2,1-2H3,(H,28,29)(H,30,31) |
| InChIKey | ZCODYZFBKBKPAV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|