C23H21ClFNO5 — CID 24769727
2-[[1-[2-(2-chloro-4-fluorophenoxy)ethoxy]naphthalene-2-carbonyl]amino]-2-methylpropanoic acid (PubChem CID 24769727) has the molecular formula C23H21ClFNO5 and a molecular weight of 445.87 g/mol. Its IUPAC name is 2-[[1-[2-(2-chloro-4-fluorophenoxy)ethoxy]naphthalene-2-carbonyl]amino]-2-methylpropanoic acid.
| Compound Name | 2-[[1-[2-(2-chloro-4-fluorophenoxy)ethoxy]naphthalene-2-carbonyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 24769727 |
| Molecular Formula | C23H21ClFNO5 |
| Molecular Weight | 445.87 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 2-[[1-[2-(2-chloro-4-fluorophenoxy)ethoxy]naphthalene-2-carbonyl]amino]-2-methylpropanoic acid |
| SMILES | CC(C)(NC(=O)c1ccc2ccccc2c1OCCOc1ccc(F)cc1Cl)C(=O)O |
| InChI | InChI=1S/C23H21ClFNO5/c1-23(2,22(28)29)26-21(27)17-9-7-14-5-3-4-6-16(14)20(17)31-12-11-30-19-10-8-15(25)13-18(19)24/h3-10,13H,11-12H2,1-2H3,(H,26,27)(H,28,29) |
| InChIKey | RARNKRJEIYBJGF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.87 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|