N-(2,4,4-trimethylpentan-2-yl)sulfamoyl chloride

C8H18ClNO2S — CID 114958284

IUPACN-(2,4,4-trimethylpentan-2-yl)sulfamoyl chloride
SMILESCC(C)(C)CC(C)(C)NS(=O)(=O)Cl
InChIInChI=1S/C8H18ClNO2S/c1-7(2,3)6-8(4,5)10-13(9,11)12/h10H,6H2,1-5H3
InChIKeyWJAVUEFQZUMZNI-UHFFFAOYSA-N
MW227.76 g/mol
LogP2.27
Rot. Bonds3

About N-(2,4,4-trimethylpentan-2-yl)sulfamoyl chloride

N-(2,4,4-trimethylpentan-2-yl)sulfamoyl chloride (PubChem CID 114958284) has the molecular formula C8H18ClNO2S and a molecular weight of 227.76 g/mol. Its IUPAC name is N-(2,4,4-trimethylpentan-2-yl)sulfamoyl chloride.

Molecular Properties

Compound NameN-(2,4,4-trimethylpentan-2-yl)sulfamoyl chloride
PubChem CID114958284
Molecular FormulaC8H18ClNO2S
Molecular Weight227.76 g/mol
Exact Mass227.07
IUPAC NameN-(2,4,4-trimethylpentan-2-yl)sulfamoyl chloride
SMILESCC(C)(C)CC(C)(C)NS(=O)(=O)Cl
InChIInChI=1S/C8H18ClNO2S/c1-7(2,3)6-8(4,5)10-13(9,11)12/h10H,6H2,1-5H3
InChIKeyWJAVUEFQZUMZNI-UHFFFAOYSA-N
XLogP2.27
TPSA46.17 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.76
LogP ≤ 52.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze N-(2,4,4-trimethylpentan-2-yl)sulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(2,4,4-trimethylpentan-2-yl)sulfamoyl chloride?
The IUPAC name of N-(2,4,4-trimethylpentan-2-yl)sulfamoyl chloride (CID 114958284) is N-(2,4,4-trimethylpentan-2-yl)sulfamoyl chloride.
What is the SMILES notation for N-(2,4,4-trimethylpentan-2-yl)sulfamoyl chloride?
The canonical SMILES for N-(2,4,4-trimethylpentan-2-yl)sulfamoyl chloride is CC(C)(C)CC(C)(C)NS(=O)(=O)Cl.
What is the InChIKey of N-(2,4,4-trimethylpentan-2-yl)sulfamoyl chloride?
The InChIKey is WJAVUEFQZUMZNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18ClNO2S/c1-7(2,3)6-8(4,5)10-13(9,11)12/h10H,6H2,1-5H3.
What are the key properties of N-(2,4,4-trimethylpentan-2-yl)sulfamoyl chloride?
N-(2,4,4-trimethylpentan-2-yl)sulfamoyl chloride has a molecular weight of 227.76 g/mol, XLogP of 2.27, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4,4-trimethylpentan-2-yl)sulfamoyl chloride is sourced from PubChem (CID 114958284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).