C10H20F2N2O2S — CID 114985160
[1-(4,4-difluorocyclohexyl)-3-methylsulfonylpropyl]hydrazine (PubChem CID 114985160) has the molecular formula C10H20F2N2O2S and a molecular weight of 270.34 g/mol. Its IUPAC name is [1-(4,4-difluorocyclohexyl)-3-methylsulfonylpropyl]hydrazine.
| Compound Name | [1-(4,4-difluorocyclohexyl)-3-methylsulfonylpropyl]hydrazine |
|---|---|
| PubChem CID | 114985160 |
| Molecular Formula | C10H20F2N2O2S |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | [1-(4,4-difluorocyclohexyl)-3-methylsulfonylpropyl]hydrazine |
| SMILES | CS(=O)(=O)CCC(NN)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C10H20F2N2O2S/c1-17(15,16)7-4-9(14-13)8-2-5-10(11,12)6-3-8/h8-9,14H,2-7,13H2,1H3 |
| InChIKey | ZWOAXOWWWHWIEV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|