C11H21F3N2O2S — CID 114985186
[3-methylsulfonyl-1-[4-(trifluoromethyl)cyclohexyl]propyl]hydrazine (PubChem CID 114985186) has the molecular formula C11H21F3N2O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is [3-methylsulfonyl-1-[4-(trifluoromethyl)cyclohexyl]propyl]hydrazine.
| Compound Name | [3-methylsulfonyl-1-[4-(trifluoromethyl)cyclohexyl]propyl]hydrazine |
|---|---|
| PubChem CID | 114985186 |
| Molecular Formula | C11H21F3N2O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [3-methylsulfonyl-1-[4-(trifluoromethyl)cyclohexyl]propyl]hydrazine |
| SMILES | CS(=O)(=O)CCC(NN)C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H21F3N2O2S/c1-19(17,18)7-6-10(16-15)8-2-4-9(5-3-8)11(12,13)14/h8-10,16H,2-7,15H2,1H3 |
| InChIKey | BVFLEMTWYVCYOU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|