C14H8Cl2O — CID 11499915
2,4-dichloro-6-(2-phenylethynyl)phenol (PubChem CID 11499915) has the molecular formula C14H8Cl2O and a molecular weight of 263.12 g/mol. Its IUPAC name is 2,4-dichloro-6-(2-phenylethynyl)phenol.
| Compound Name | 2,4-dichloro-6-(2-phenylethynyl)phenol |
|---|---|
| PubChem CID | 11499915 |
| Molecular Formula | C14H8Cl2O |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 2,4-dichloro-6-(2-phenylethynyl)phenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1C#Cc1ccccc1 |
| InChI | InChI=1S/C14H8Cl2O/c15-12-8-11(14(17)13(16)9-12)7-6-10-4-2-1-3-5-10/h1-5,8-9,17H |
| InChIKey | AZEVTHKNUXBCGH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|