C14H11ClN2 — CID 58387126
4-chloro-5-(2-phenylethynyl)benzene-1,2-diamine (PubChem CID 58387126) has the molecular formula C14H11ClN2 and a molecular weight of 242.71 g/mol. Its IUPAC name is 4-chloro-5-(2-phenylethynyl)benzene-1,2-diamine.
| Compound Name | 4-chloro-5-(2-phenylethynyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 58387126 |
| Molecular Formula | C14H11ClN2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 4-chloro-5-(2-phenylethynyl)benzene-1,2-diamine |
| SMILES | Nc1cc(Cl)c(C#Cc2ccccc2)cc1N |
| InChI | InChI=1S/C14H11ClN2/c15-12-9-14(17)13(16)8-11(12)7-6-10-4-2-1-3-5-10/h1-5,8-9H,16-17H2 |
| InChIKey | UBBVQXUYMURQAT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|