C18H27NO — CID 11500051
1-[(1R,2R)-2-methoxy-1-phenylcyclohexyl]piperidine (PubChem CID 11500051) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 1-[(1R,2R)-2-methoxy-1-phenylcyclohexyl]piperidine.
| Compound Name | 1-[(1R,2R)-2-methoxy-1-phenylcyclohexyl]piperidine |
|---|---|
| PubChem CID | 11500051 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 1-[(1R,2R)-2-methoxy-1-phenylcyclohexyl]piperidine |
| SMILES | CO[C@@H]1CCCC[C@]1(c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C18H27NO/c1-20-17-12-6-7-13-18(17,16-10-4-2-5-11-16)19-14-8-3-9-15-19/h2,4-5,10-11,17H,3,6-9,12-15H2,1H3/t17-,18-/m1/s1 |
| InChIKey | FHUOFGBHISRHIG-QZTJIDSGSA-N |
| XLogP | 3.96 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |