C22H24O3 — CID 11500958
(2R,3R,3aS,4R,6S,6aS)-4,6-bis(hydroxymethyl)-2,3-diphenyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one (PubChem CID 11500958) has the molecular formula C22H24O3 and a molecular weight of 336.43 g/mol. Its IUPAC name is (2R,3R,3aS,4R,6S,6aS)-4,6-bis(hydroxymethyl)-2,3-diphenyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one.
| Compound Name | (2R,3R,3aS,4R,6S,6aS)-4,6-bis(hydroxymethyl)-2,3-diphenyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one |
|---|---|
| PubChem CID | 11500958 |
| Molecular Formula | C22H24O3 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | (2R,3R,3aS,4R,6S,6aS)-4,6-bis(hydroxymethyl)-2,3-diphenyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one |
| SMILES | O=C1[C@@H]2[C@@H](CO)C[C@@H](CO)[C@@H]2[C@@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H24O3/c23-12-16-11-17(13-24)21-19(16)18(14-7-3-1-4-8-14)20(22(21)25)15-9-5-2-6-10-15/h1-10,16-21,23-24H,11-13H2/t16-,17+,18+,19+,20-,21+/m0/s1 |
| InChIKey | OZVYDTHZHPJLTK-LDIYZUBKSA-N |
| XLogP | 2.99 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |