C19H26O3 — CID 35025596
(3aS,4R,5R,6aR)-5-hydroxy-4-[(3R)-3-hydroxy-5-phenylpentyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 35025596) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (3aS,4R,5R,6aR)-5-hydroxy-4-[(3R)-3-hydroxy-5-phenylpentyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | (3aS,4R,5R,6aR)-5-hydroxy-4-[(3R)-3-hydroxy-5-phenylpentyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 35025596 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (3aS,4R,5R,6aR)-5-hydroxy-4-[(3R)-3-hydroxy-5-phenylpentyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | O=C1C[C@H]2C[C@@H](O)[C@H](CC[C@@H](O)CCc3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C19H26O3/c20-15(7-6-13-4-2-1-3-5-13)8-9-17-18-12-16(21)10-14(18)11-19(17)22/h1-5,14-15,17-20,22H,6-12H2/t14-,15-,17+,18-,19+/m0/s1 |
| InChIKey | RBQLIGIUYJRPOG-NXJYUQPGSA-N |
| XLogP | 2.74 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |