C18H20O2 — CID 15146782
(3aS,4S,6aS)-4-hydroxy-3a,6a-dimethyl-4-(2-phenylethynyl)-2,3,5,6-tetrahydropentalen-1-one (PubChem CID 15146782) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is (3aS,4S,6aS)-4-hydroxy-3a,6a-dimethyl-4-(2-phenylethynyl)-2,3,5,6-tetrahydropentalen-1-one.
| Compound Name | (3aS,4S,6aS)-4-hydroxy-3a,6a-dimethyl-4-(2-phenylethynyl)-2,3,5,6-tetrahydropentalen-1-one |
|---|---|
| PubChem CID | 15146782 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | (3aS,4S,6aS)-4-hydroxy-3a,6a-dimethyl-4-(2-phenylethynyl)-2,3,5,6-tetrahydropentalen-1-one |
| SMILES | C[C@]12CCC(=O)[C@@]1(C)CC[C@]2(O)C#Cc1ccccc1 |
| InChI | InChI=1S/C18H20O2/c1-16-12-13-18(20,17(16,2)10-9-15(16)19)11-8-14-6-4-3-5-7-14/h3-7,20H,9-10,12-13H2,1-2H3/t16-,17+,18-/m1/s1 |
| InChIKey | GUIXAPOOTIQQDI-FGTMMUONSA-N |
| XLogP | 2.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|