C19H24O4 — CID 11616677
[(1S,3R,3aS,4R,5R,6aS)-3-(hydroxymethyl)-4-methyl-6-oxo-5-phenyl-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-yl]methyl acetate (PubChem CID 11616677) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is [(1S,3R,3aS,4R,5R,6aS)-3-(hydroxymethyl)-4-methyl-6-oxo-5-phenyl-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-yl]methyl acetate.
| Compound Name | [(1S,3R,3aS,4R,5R,6aS)-3-(hydroxymethyl)-4-methyl-6-oxo-5-phenyl-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 11616677 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | [(1S,3R,3aS,4R,5R,6aS)-3-(hydroxymethyl)-4-methyl-6-oxo-5-phenyl-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1C[C@@H](CO)[C@@H]2[C@@H](C)[C@H](c3ccccc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C19H24O4/c1-11-16-14(9-20)8-15(10-23-12(2)21)18(16)19(22)17(11)13-6-4-3-5-7-13/h3-7,11,14-18,20H,8-10H2,1-2H3/t11-,14+,15-,16+,17-,18-/m1/s1 |
| InChIKey | HZDGNNOXJMWRAR-JNLAQROYSA-N |
| XLogP | 2.41 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |