C22H30O4 — CID 11515994
[(1S,3R,3aS,4R,5S,6aS)-5-butyl-3-(hydroxymethyl)-6-oxo-4-phenyl-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-yl]methyl acetate (PubChem CID 11515994) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is [(1S,3R,3aS,4R,5S,6aS)-5-butyl-3-(hydroxymethyl)-6-oxo-4-phenyl-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-yl]methyl acetate.
| Compound Name | [(1S,3R,3aS,4R,5S,6aS)-5-butyl-3-(hydroxymethyl)-6-oxo-4-phenyl-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 11515994 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | [(1S,3R,3aS,4R,5S,6aS)-5-butyl-3-(hydroxymethyl)-6-oxo-4-phenyl-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-yl]methyl acetate |
| SMILES | CCCC[C@@H]1C(=O)[C@@H]2[C@@H](COC(C)=O)C[C@@H](CO)[C@@H]2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H30O4/c1-3-4-10-18-19(15-8-6-5-7-9-15)20-16(12-23)11-17(13-26-14(2)24)21(20)22(18)25/h5-9,16-21,23H,3-4,10-13H2,1-2H3/t16-,17+,18-,19-,20+,21+/m0/s1 |
| InChIKey | MMEFXLMWCUBEKU-NXMWLWCLSA-N |
| XLogP | 3.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |