C24H26O4 — CID 11596000
[(1S,3R,3aS,4R,5R,6aS)-3-(hydroxymethyl)-6-oxo-4,5-diphenyl-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-yl]methyl acetate (PubChem CID 11596000) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is [(1S,3R,3aS,4R,5R,6aS)-3-(hydroxymethyl)-6-oxo-4,5-diphenyl-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-yl]methyl acetate.
| Compound Name | [(1S,3R,3aS,4R,5R,6aS)-3-(hydroxymethyl)-6-oxo-4,5-diphenyl-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 11596000 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | [(1S,3R,3aS,4R,5R,6aS)-3-(hydroxymethyl)-6-oxo-4,5-diphenyl-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1C[C@@H](CO)[C@H]2[C@@H]1C(=O)[C@@H](c1ccccc1)[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C24H26O4/c1-15(26)28-14-19-12-18(13-25)21-20(16-8-4-2-5-9-16)22(24(27)23(19)21)17-10-6-3-7-11-17/h2-11,18-23,25H,12-14H2,1H3/t18-,19+,20+,21+,22-,23+/m0/s1 |
| InChIKey | FDYVSADKPMILRP-HZMAHWLLSA-N |
| XLogP | 3.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |