C25H24O4 — CID 633633
methyl 5-benzhydrylidene-1-oxo-3a,4,6,6a,7,7a-hexahydro-3H-pentaleno[1,2-c]furan-3b-carboxylate (PubChem CID 633633) has the molecular formula C25H24O4 and a molecular weight of 388.46 g/mol. Its IUPAC name is methyl 5-benzhydrylidene-1-oxo-3a,4,6,6a,7,7a-hexahydro-3H-pentaleno[1,2-c]furan-3b-carboxylate.
| Compound Name | methyl 5-benzhydrylidene-1-oxo-3a,4,6,6a,7,7a-hexahydro-3H-pentaleno[1,2-c]furan-3b-carboxylate |
|---|---|
| PubChem CID | 633633 |
| Molecular Formula | C25H24O4 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | methyl 5-benzhydrylidene-1-oxo-3a,4,6,6a,7,7a-hexahydro-3H-pentaleno[1,2-c]furan-3b-carboxylate |
| SMILES | COC(=O)C12CC(=C(c3ccccc3)c3ccccc3)CC1CC1C(=O)OCC12 |
| InChI | InChI=1S/C25H24O4/c1-28-24(27)25-14-18(12-19(25)13-20-21(25)15-29-23(20)26)22(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,19-21H,12-15H2,1H3 |
| InChIKey | WDOTZDQCNVAHDH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |