C16H16N2O6S — CID 11501455
[(2R,3S,4R,5R)-5-(4-carbamoyl-1,3-thiazol-2-yl)-3,4-dihydroxyoxolan-2-yl]methyl benzoate (PubChem CID 11501455) has the molecular formula C16H16N2O6S and a molecular weight of 364.38 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-carbamoyl-1,3-thiazol-2-yl)-3,4-dihydroxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-carbamoyl-1,3-thiazol-2-yl)-3,4-dihydroxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11501455 |
| Molecular Formula | C16H16N2O6S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-carbamoyl-1,3-thiazol-2-yl)-3,4-dihydroxyoxolan-2-yl]methyl benzoate |
| SMILES | NC(=O)c1csc([C@@H]2O[C@H](COC(=O)c3ccccc3)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C16H16N2O6S/c17-14(21)9-7-25-15(18-9)13-12(20)11(19)10(24-13)6-23-16(22)8-4-2-1-3-5-8/h1-5,7,10-13,19-20H,6H2,(H2,17,21)/t10-,11-,12-,13-/m1/s1 |
| InChIKey | IOIPUSCZQCIFTO-FDYHWXHSSA-N |
| XLogP | 0.26 |
| TPSA | 131.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |